CymitQuimica logo

CAS 120720-70-9

:

1H-Benzimidazole,1-(fluoromethyl)-2-methyl-(9CI)

Description:
1H-Benzimidazole, 1-(fluoromethyl)-2-methyl- (CAS 120720-70-9) is a heterocyclic organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of a fluoromethyl group at the 1-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its non-polar characteristics. The fluoromethyl group enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological properties, including potential antimicrobial or anticancer activities, due to the structural features of the benzimidazole moiety. Additionally, its stability and reactivity can be affected by the presence of the fluorine atom, which can alter electronic properties and steric hindrance. Overall, 1H-Benzimidazole, 1-(fluoromethyl)-2-methyl- is a compound of interest for further research in both synthetic and medicinal chemistry.
Formula:C9H9FN2
InChI:InChI=1/C9H9FN2/c1-7-11-8-4-2-3-5-9(8)12(7)6-10/h2-5H,6H2,1H3
SMILES:Cc1nc2ccccc2n1CF
Synonyms:
  • 1-(fluoromethyl)-2-methyl-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.