
CAS 1207260-07-8
:1-(6-Methoxy-2-methyl-3-pyridinyl)-1-propanone
Description:
1-(6-Methoxy-2-methyl-3-pyridinyl)-1-propanone, identified by its CAS number 1207260-07-8, is an organic compound characterized by its pyridine ring structure, which contributes to its aromatic properties. The presence of a methoxy group and a methyl group on the pyridine ring enhances its lipophilicity and may influence its biological activity. This compound features a propanone functional group, indicating it has ketone characteristics, which can participate in various chemical reactions, such as nucleophilic additions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyridine moiety's known role in drug design. Additionally, the compound's solubility and stability can be affected by the substituents on the pyridine ring, making it an interesting candidate for further research in organic synthesis and pharmacology. Overall, 1-(6-Methoxy-2-methyl-3-pyridinyl)-1-propanone exhibits unique chemical properties that warrant exploration in various scientific fields.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-4-9(12)8-5-6-10(13-3)11-7(8)2/h5-6H,4H2,1-3H3
InChI key:InChIKey=LGYSQQYCSVPKHN-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(C)N=C(OC)C=C1
Synonyms:- 1-(6-Methoxy-2-methyl-3-pyridinyl)-1-propanone
- 1-Propanone, 1-(6-methoxy-2-methyl-3-pyridinyl)-
- 1-(6-Methoxy-2-methylpyridin-3-yl)propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.