CAS 1207339-61-4

2-[[[[3-(Methylthio)phenyl]amino]carbonyl]oxy]ethyl 2-propenoate

Description:

2-[[[[3-(Methylthio)phenyl]amino]carbonyl]oxy]ethyl 2-propenoate is a chemical compound characterized by its complex structure, which includes an ester functional group and an amide linkage. The presence of the methylthio group suggests that it may exhibit specific reactivity and solubility properties, potentially influencing its behavior in various chemical environments. This compound features a propenoate moiety, indicating it may participate in polymerization reactions, making it of interest in materials science and organic synthesis. The aromatic ring contributes to its stability and may also affect its electronic properties, which can be relevant in applications such as pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic uses. Overall, the characteristics of this compound, including its functional groups and structural features, position it as a versatile entity in both synthetic and applied chemistry contexts.

Formula: C₁₃H₁₅NO₄S

InChI: InChI=1S/C13H15NO4S/c1-3-12(15)17-7-8-18-13(16)14-10-5-4-6-11(9-10)19-2/h3-6,9H,1,7-8H2,2H3,(H,14,16)

InChI key: InChIKey=FYRZOXZLXPDHOF-UHFFFAOYSA-N

SMILES: N(C(OCCOC(C=C)=O)=O)C1=CC(SC)=CC=C1

Synonyms:

• 2-[[[[3-(Methylthio)phenyl]amino]carbonyl]oxy]ethyl 2-propenoate
• 2-([[3-(Methylsulphanyl)phenyl]carbamoyl]oxy)ethyl prop-2-enoate
• 2-Propenoic acid, 2-[[[[3-(methylthio)phenyl]amino]carbonyl]oxy]ethyl ester
• 2-([[3-(Methylsulfanyl)phenyl]carbamoyl]oxy)ethyl 2-propenoate

2-Propenoic acid, 2-[[[[3-(methylthio)phenyl]amino]carbonyl]oxy]ethyl ester

CAS: 1207339-61-4

Formula: C₁₃H₁₅NO₄S

Color and Shape: Solid

Molecular weight: 281.3275

Ref: IN-DA01S23I