CymitQuimica logo

CAS 1207362-49-9

:

6-(Phenylmethoxy)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinamine

Description:
6-(Phenylmethoxy)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridinamine core, a phenylmethoxy group, and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to form stable complexes with various biological targets. The compound's molecular architecture may contribute to its solubility and reactivity, influencing its pharmacokinetic properties. Additionally, the phenyl and pyridine rings can participate in π-π stacking interactions, which may enhance its binding affinity to specific receptors or enzymes. The compound's unique features make it a subject of interest for research in areas such as organic synthesis, material science, and biological applications. However, detailed studies on its biological activity, toxicity, and stability are essential for understanding its potential uses and safety profile.
Formula:C24H27BN2O3
InChI:InChI=1S/C24H27BN2O3/c1-23(2)24(3,4)30-25(29-23)19-13-15-20(16-14-19)26-21-11-8-12-22(27-21)28-17-18-9-6-5-7-10-18/h5-16H,17H2,1-4H3,(H,26,27)
InChI key:InChIKey=CLOYZXDDXKQIQG-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(NC=3N=C(OCC4=CC=CC=C4)C=CC3)C=C2
Synonyms:
  • 6-(Phenylmethoxy)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinamine
  • 2-Pyridinamine, 6-(phenylmethoxy)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.