CAS 120739-69-7
:N-methyl-1-quinolin-3-ylmethanamine
Description:
N-methyl-1-quinolin-3-ylmethanamine, identified by its CAS number 120739-69-7, is an organic compound that features a quinoline ring system, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound is characterized by the presence of a methyl group attached to the nitrogen atom of the amine, as well as a methanamine group linked to the quinoline structure. It typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The quinoline moiety contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties. N-methyl-1-quinolin-3-ylmethanamine may be of interest in medicinal chemistry and drug development, particularly in the context of exploring its interactions with biological targets. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used, making it a compound of interest for further research in various chemical and biological applications.
Formula:C11H12N2
InChI:InChI=1/C11H12N2/c1-12-7-9-6-10-4-2-3-5-11(10)13-8-9/h2-6,8,12H,7H2,1H3
SMILES:CNCc1cc2ccccc2nc1
Synonyms:- 3-quinolinemethanamine, N-methyl-
- VITAS-BB TBB011771
- N-Methyl-N-(3-quinolinylmethyl)amine
- CHEMBRDG-BB 4003836
- N-METHYL-1-QUINOLIN-3-YLMETHANAMINE
- N-Methyl-1-quinolin-3-ylmethanamine dihydrochloride
- N-methyl-1-quinolin-3-ylmethanamine(SALTDATA: 1HCl 1.7H2O)
- N-methyl-1-quinolin-3-ylmethanamine hydrochloride
- AKOS ISYA00839
- N-methyl-3-quinolinemethanamine
- AKOS P-2123531
- methyl(quinolin-3-ylmethyl)amine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
