CAS 120740-03-6
:3-Pyridinemethanamine,6-fluoro-N-methyl-(9CI)
Description:
3-Pyridinemethanamine, 6-fluoro-N-methyl- (CAS 120740-03-6) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methanamine group, indicating the presence of an amine functional group attached to a methylene bridge. The "6-fluoro" designation indicates that a fluorine atom is substituted at the sixth position of the pyridine ring, which can influence the compound's reactivity and biological activity. The N-methyl group suggests that a methyl group is attached to the nitrogen atom of the amine, enhancing its lipophilicity and potentially affecting its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions dictated by its functional groups and overall structure.
Formula:C7H9FN2
InChI:InChI=1S/C7H9FN2/c1-9-4-6-2-3-7(8)10-5-6/h2-3,5,9H,4H2,1H3
InChI key:InChIKey=FGIMOABAGJTCSV-UHFFFAOYSA-N
SMILES:C(NC)C=1C=CC(F)=NC1
Synonyms:- 6-Fluoro-N-methyl-3-pyridinemethanamine
- 3-Pyridinemethanamine, 6-fluoro-N-methyl-
- 1-(6-Fluoropyridin-3-yl)-N-methylmethanamine
- N-(6-Fluoro-3-pyridylmethyl)-N-methylamine
- [(6-Fluoropyridin-3-yl)methyl](methyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.