CAS 120740-05-8
:6-Bromo-N-ethyl-3-pyridinemethanamine
Description:
6-Bromo-N-ethyl-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The N-ethyl group indicates that there is an ethyl substituent attached to the nitrogen atom, which can influence the compound's solubility and biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. Additionally, the bromine substituent can serve as a leaving group in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Overall, 6-Bromo-N-ethyl-3-pyridinemethanamine is of interest in medicinal chemistry and may have potential applications in drug development or as a building block in the synthesis of other chemical entities.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c1-2-10-5-7-3-4-8(9)11-6-7/h3-4,6,10H,2,5H2,1H3
InChI key:InChIKey=BFLXSKZTPUZOCG-UHFFFAOYSA-N
SMILES:C(NCC)C=1C=CC(Br)=NC1
Synonyms:- 6-Bromo-N-ethyl-3-pyridinemethanamine
- (6-Bromo-pyridin-3-ylmethyl)-ethyl-amine
- N-(6-Bromo-3-pyridylmethyl)-N-ethylamine
- 3-Pyridinemethanamine, 6-bromo-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
