CymitQuimica logo

CAS 120740-09-2

:

2-[(2-Chloro-5-thiazolyl)methyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[(2-Chloro-5-thiazolyl)methyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 120740-09-2, is a chemical compound characterized by its complex structure, which includes an isoindole core and a thiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of the chloro and thiazole groups can impart specific reactivity, making it potentially useful in medicinal chemistry and as a building block in organic synthesis. Its molecular structure suggests potential biological activity, and compounds of this type are often investigated for their pharmacological properties. Additionally, the compound may exhibit characteristics such as stability under standard laboratory conditions, but it is essential to handle it with care due to the presence of chlorine, which can influence its reactivity and toxicity. As with any chemical substance, proper safety protocols should be followed when handling this compound in a laboratory setting.
Formula:C12H7ClN2O2S
InChI:InChI=1S/C12H7ClN2O2S/c13-12-14-5-7(18-12)6-15-10(16)8-3-1-2-4-9(8)11(15)17/h1-5H,6H2
InChI key:InChIKey=KZDJNJBEHMLRES-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC=3SC(Cl)=NC3)=CC=CC2
Synonyms:
  • 2-[(2-Chloro-1,3-thiazol-5-yl)methyl]-2,3-dihydro-1H-isoindole-1,3-dione
  • 2-[(2-Chloro-5-thiazolyl)methyl]-1H-isoindole-1,3(2H)-dione
  • 2-[(2-Chloro-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione
  • 1H-Isoindole-1,3(2H)-dione, 2-[(2-chloro-5-thiazolyl)methyl]-
  • N-(2-Chloro-5-thiazolylmethyl)phthalimide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.