CAS 1207426-84-3

5-Chloro-2-(2-methylpropyl)thiazole

Description:

5-Chloro-2-(2-methylpropyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a chlorine atom at the 5-position and a branched alkyl group (2-methylpropyl) at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The thiazole moiety is often associated with biological activity, making compounds like this of interest in medicinal chemistry. Additionally, the chlorine substituent can influence the compound's reactivity and solubility, affecting its behavior in various chemical environments. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 5-Chloro-2-(2-methylpropyl)thiazole exemplifies the diverse chemistry of thiazole derivatives.

Formula: C₇H₁₀ClNS

InChI: InChI=1S/C7H10ClNS/c1-5(2)3-7-9-4-6(8)10-7/h4-5H,3H2,1-2H3

InChI key: InChIKey=IGCIAIFVYWYLMI-UHFFFAOYSA-N

SMILES: C(C(C)C)C=1SC(Cl)=CN1

Synonyms:

• Thiazole, 5-chloro-2-(2-methylpropyl)-
• 5-Chloro-2-(2-methylpropyl)thiazole