CAS 120743-27-3
:Benzenamine, N-butyl-, homopolymer
Description:
Benzenamine, N-butyl-, homopolymer, identified by CAS number 120743-27-3, is a synthetic polymer derived from the polymerization of N-butyl aniline. This compound typically exhibits characteristics common to aromatic amines, including good thermal stability and resistance to degradation. The polymer structure contributes to its mechanical strength and flexibility, making it suitable for various applications in coatings, adhesives, and sealants. It is generally soluble in organic solvents and may have limited solubility in water due to its hydrophobic nature. The presence of the amine functional group can impart basicity and reactivity, allowing for further chemical modifications. Safety considerations are important, as aromatic amines can be toxic and potentially carcinogenic; therefore, handling should be conducted with appropriate precautions. Overall, Benzenamine, N-butyl-, homopolymer is valued for its unique properties that combine the benefits of both aromatic compounds and polymeric materials.
Formula:(C10H15N)x
InChI:InChI=1S/C10H15N/c1-2-3-9-11-10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3
InChI key:InChIKey=VSHTWPWTCXQLQN-UHFFFAOYSA-N
SMILES:N(CCCC)C1=CC=CC=C1
Synonyms:- N-Butylaniline homopolymer
- Benzenamine, N-butyl-, homopolymer
- Poly(N-butylaniline)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
