CAS 120743-99-9

4-((TERT-BUTYLDIMETHYLSILYL)OXY)BENZALD&

Description:

The chemical substance known as 4-((tert-butyldimethylsilyl)oxy)benzaldehyde, with the CAS number 120743-99-9, is an organic compound characterized by the presence of a benzaldehyde functional group and a tert-butyldimethylsilyl (TBDMS) protecting group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. The TBDMS group is commonly used in organic synthesis to protect hydroxyl groups, enhancing the compound's stability and reactivity during various chemical reactions. The presence of the aldehyde functional group indicates that this compound can participate in nucleophilic addition reactions, making it useful in the synthesis of more complex organic molecules. Additionally, the compound's structure suggests it may exhibit moderate polarity, influencing its solubility in organic solvents. Overall, 4-((tert-butyldimethylsilyl)oxy)benzaldehyde serves as a valuable intermediate in organic synthesis, particularly in the field of medicinal chemistry and materials science.

Formula: C₁₃H₂₀O₂Si

InChI: InChI=1/C13H20O2Si/c1-13(2,3)16(4,5)15-12-8-6-11(10-14)7-9-12/h6-10H,1-5H3

SMILES: CC(C)(C)[Si](C)(C)Oc1ccc(cc1)C=O

Synonyms:

• 4-(tert-Butyldimethylsiloxy)benzaldehyde
• 4-{[Tert-Butyl(Dimethyl)Silyl]Oxy}Benzaldehyde

4-(t-Butyldimethylsilyloxy)benzaldehyde

CAS: 120743-99-9

Formula: C₁₃H₂₀O₂Si

Purity: 96%

Color and Shape: Liquid

Molecular weight: 236.3822

Ref: IN-DA003JXK

4-[(tert-Butyldimethylsilyl)oxy]benzaldehyde

CAS: 120743-99-9

Formula: C₁₃H₂₀O₂Si

Purity: >97.0%(GC)

Color and Shape: Colorless to Yellow clear liquid

Molecular weight: 236.39

Ref: 3B-D6404

4-(t-Butyldimethylsilyloxy)benzaldehyde

CAS: 120743-99-9

4-(t-Butyldimethylsilyloxy)benzaldehyde

Formula: C₁₃H₂₀O₂Si

Purity: 96%

Color and Shape: yellow liquid

Molecular weight: 236.38g/mol

Ref: 54-OR900279

4-[(tert-Butyldimethylsilyl)oxy]benzaldehyde

CAS: 120743-99-9

Purity: 96%

Molecular weight: 236.3860016

Ref: 10-F635426

4-(tert-Butyldimethylsilyloxy)benzaldehyde

CAS: 120743-99-9

4-(tert-Butyldimethylsilyloxy)benzaldehyde is a molecule that belongs to the group of anionic compounds. It is synthesized from phenol and tert-butyldimethylchlorosilane. This compound is used in the synthesis of paclitaxel, which has been shown to be effective against breast cancer cells. 4-(tert-Butyldimethylsilyloxy)benzaldehyde can also be used as a precursor for other functionalized molecules, such as copolymers. This compound undergoes copolymerization with various other monomers, such as vinyl acetate, acrylate esters, and acrylic acid derivatives to form polyesters. 4-(tert-Butyldimethylsilyloxy)benzaldehyde reacts with fluoride ion or chloride ion in solution to produce colorimetric changes. It also reacts with butyllithium to form primary alcohols.

Formula: C₁₃H₂₀O₂Si

Purity: Min. 95%

Molecular weight: 236.38 g/mol

Ref: 3D-VEA74399

4-(tert-Butyldimethylsilyloxy)benzaldehyde

CAS: 120743-99-9

Formula: C₁₃H₂₀O₂Si

Molecular weight: 236.39

Ref: ST-EA-CP-B14103