CAS 1207447-40-2

(αR)-Tetrahydro-α-hydroxy-2H-pyran-4-propanoic acid

Description:

(αR)-Tetrahydro-α-hydroxy-2H-pyran-4-propanoic acid is a chemical compound characterized by its unique bicyclic structure, which includes a tetrahydropyran ring and a propanoic acid moiety. This compound features a hydroxyl group attached to the tetrahydropyran ring, contributing to its potential as a chiral building block in organic synthesis. The presence of the α-hydroxy group indicates that it may exhibit interesting reactivity, particularly in esterification and oxidation reactions. Its stereochemistry, denoted by the (αR) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. This compound may have applications in pharmaceuticals or as an intermediate in the synthesis of more complex organic compounds. Additionally, its solubility and stability under various conditions would be important characteristics to consider for practical applications. Overall, (αR)-Tetrahydro-α-hydroxy-2H-pyran-4-propanoic acid represents a versatile structure with potential utility in synthetic chemistry and medicinal chemistry.

Formula: C₈H₁₄O₄

InChI: InChI=1S/C8H14O4/c9-7(8(10)11)5-6-1-3-12-4-2-6/h6-7,9H,1-5H2,(H,10,11)/t7-/m1/s1

InChI key: InChIKey=PNYHOVZKYXHIRF-SSDOTTSWSA-N

SMILES: C([C@H](C(O)=O)O)C1CCOCC1

Synonyms:

• (2R)-2-Hydroxy-3-(oxan-4-yl)propanoic acid
• (αR)-Tetrahydro-α-hydroxy-2H-pyran-4-propanoic acid
• 2H-Pyran-4-propanoic acid, tetrahydro-α-hydroxy-, (αR)-