CAS 1207453-91-5: 4-Amino-6-fluoro-1(3H)-isobenzofuranone

Description:4-Amino-6-fluoro-1(3H)-isobenzofuranone is a chemical compound characterized by its unique structure, which includes an isobenzofuranone core with an amino group and a fluorine atom substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The fluorine atom can enhance lipophilicity and may affect the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure may allow for various synthetic modifications, potentially leading to derivatives with altered properties. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and interaction with target systems. Overall, 4-Amino-6-fluoro-1(3H)-isobenzofuranone represents a versatile compound with potential implications in various fields of research and industry.

Formula:C₈H₆FNO₂

InChI:InChI=1S/C8H6FNO2/c9-4-1-5-6(7(10)2-4)3-12-8(5)11/h1-2H,3,10H2

InChI key:InChIKey=DSZCXDVJAIFZLL-UHFFFAOYSA-N

SMILES:O=C1OCC=2C(N)=CC(F)=CC12

Synonyms:
1(3H)-Isobenzofuranone, 4-amino-6-fluoro-
4-Amino-6-fluoroisobenzofuran-1(3H)-one
4-Amino-6-fluoro-1(3H)-isobenzofuranone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Amino-6-fluoro-3H-isobenzofuran-1-one REF: IN-DA0095ZZCAS: 1207453-91-5	95%	56.00 €~300.00 €	Mon 03 Mar 25
4-Amino-6-fluoroisobenzofuran-1(3H)-one REF: 54-PC101292CAS: 1207453-91-5	0.95	116.00 €~209.00 €	Tue 04 Mar 25
4-Amino-6-fluoroisobenzofuran-1(3H)-one REF: 10-F668494CAS: 1207453-91-5	97%	To inquire	Thu 13 Mar 25
4-Amino-6-fluoroisobenzofuran-1(3H)-one REF: 3D-HYB45391CAS: 1207453-91-5	Min. 95%	- - -	Discontinued product