CAS 1207455-27-3

4-Amino-6-chloro-1(3H)-isobenzofuranone

Description:

4-Amino-6-chloro-1(3H)-isobenzofuranone is an organic compound characterized by its unique bicyclic structure, which includes an isobenzofuranone moiety. This compound features an amino group (-NH2) and a chlorine atom (Cl) attached to the aromatic system, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. The chlorine atom can also influence the compound's electronic properties and solubility. Typically, compounds of this nature may exhibit biological activity, which could be explored for pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. As with many organic compounds, the physical properties such as solubility, melting point, and stability can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₈H₆ClNO₂

InChI: InChI=1S/C8H6ClNO2/c9-4-1-5-6(7(10)2-4)3-12-8(5)11/h1-2H,3,10H2

InChI key: InChIKey=DONYHVCNOCJLGQ-UHFFFAOYSA-N

SMILES: NC1=C2C(=CC(Cl)=C1)C(=O)OC2

Synonyms:

• 4-Amino-6-chloro-1(3H)-isobenzofuranone
• 1(3H)-Isobenzofuranone, 4-amino-6-chloro-