CAS 120747-41-3

9-Trifluoromethyl-9H-fluoren-9-ol

Description:

9-Trifluoromethyl-9H-fluoren-9-ol is an organic compound characterized by the presence of a trifluoromethyl group and a hydroxyl group attached to a fluorene structure. This compound typically exhibits a white to off-white crystalline appearance. The trifluoromethyl group contributes to its unique electronic properties, enhancing its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The hydroxyl group provides hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Due to the presence of fluorine atoms, this compound may exhibit increased lipophilicity and stability compared to its non-fluorinated counterparts. Its molecular structure allows for potential applications in materials science, particularly in the development of fluorinated polymers or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit unique toxicological profiles. Overall, 9-Trifluoromethyl-9H-fluoren-9-ol is a valuable compound in the field of organic chemistry with diverse applications.

Formula: C₁₄H₉F₃O

InChI: InChI=1/C14H9F3O/c15-14(16,17)13(18)11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,18H

SMILES: c1ccc2c(c1)c1ccccc1C2(C(F)(F)F)O