CAS 120747-85-5

2-Amino-5-pyrimidinemethanol

Description:

2-Amino-5-pyrimidinemethanol is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the pyrimidine ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxymethyl group. The compound may exhibit properties such as being a weak base due to the amino group, and it can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often found in biologically active compounds. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₇N₃O

InChI: InChI=1S/C5H7N3O/c6-5-7-1-4(3-9)2-8-5/h1-2,9H,3H2,(H2,6,7,8)

InChI key: InChIKey=NUGGQZDIPXLGQW-UHFFFAOYSA-N

SMILES: C(O)C=1C=NC(N)=NC1

Synonyms:

• (2-Aminopyrimidin-5-Yl)Methanol
• 2-Amino-5-pyrimidinemethanol
• 5-Pyrimidinemethanol, 2-amino-

(2-Aminopyrimidin-5-yl)methanol

CAS: 120747-85-5

Formula: C₅H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.1286

Ref: IN-DA007572

(2-Aminopyrimidin-5-yl)methanol

CAS: 120747-85-5

(2-Aminopyrimidin-5-yl)methanol

Purity: 98%

Molecular weight: 125.13g/mol

Ref: 54-OR345712

(2-Aminopyrimidin-5-yl)methanol

CAS: 120747-85-5

Formula: C₅H₇N₃O

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 125.131

Ref: 10-F215267

(2-Aminopyrimidin-5-yl)methanol

CAS: 120747-85-5

(2-Aminopyrimidin-5-yl)methanol is a research chemical commonly used in the field of chemistry. It is a versatile compound that can undergo various reactions, including methylation using chlorotrimethylsilane. This compound is often employed in laboratory settings for its ability to form new chemical bonds and facilitate the synthesis of complex organic molecules. Researchers value (2-Aminopyrimidin-5-yl)methanol for its unique properties and its potential applications in drug discovery and other scientific endeavors.

Formula: C₅H₇N₃O

Purity: Min. 95%

Molecular weight: 125.13 g/mol

Ref: 3D-VEA74785