CAS 1207515-90-9

Bis(4-methoxybenzoyl)diethylgermanium

Description:

Bis(4-methoxybenzoyl)diethylgermanium is an organometallic compound characterized by its germanium center bonded to two diethyl groups and two 4-methoxybenzoyl moieties. This compound typically exhibits a relatively low melting point and is soluble in organic solvents, making it suitable for various applications in organic synthesis and materials science. The presence of the methoxy groups enhances its solubility and may influence its reactivity, particularly in coordination chemistry. The germanium atom in this compound can exhibit oxidation states commonly found in organometallic chemistry, which may allow for interesting redox properties. Additionally, the aromatic benzoyl groups contribute to the compound's stability and may provide sites for further chemical modification. Overall, Bis(4-methoxybenzoyl)diethylgermanium is of interest in research areas such as catalysis, polymer science, and the development of new materials due to its unique structural features and potential reactivity.

Formula: C₂₀H₂₄GeO₄

InChI: InChI=1S/C20H24GeO4/c1-5-21(6-2,19(22)15-7-11-17(24-3)12-8-15)20(23)16-9-13-18(25-4)14-10-16/h7-14H,5-6H2,1-4H3

InChI key: InChIKey=KIMKGBGMXUPKJT-UHFFFAOYSA-N

SMILES: [Ge](C(=O)C1=CC=C(OC)C=C1)(C(=O)C2=CC=C(OC)C=C2)(CC)CC

Synonyms:

• Bis(4-methoxybenzoyl)diethylgermanium
• 1,1′-(Diethylgermylene)bis[1-(4-methoxyphenyl)methanone]
• Diethylbis(4-methoxybenzoyl)germane
• Ivocerin
• Methanone, 1,1′-(diethylgermylene)bis[1-(4-methoxyphenyl)-

Bis(4-methoxybenzoyl)diethylgermanium

CAS: 1207515-90-9

Bis(4-methoxybenzoyl)diethylgermanium

Molecular weight: 401.04216g/mol

Ref: 54-OR1021986