
CAS 1207529-88-1
:5-Chloro-2-methyl-3-pyridinecarbonyl chloride
Description:
5-Chloro-2-methyl-3-pyridinecarbonyl chloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro substituent at the 5-position and a methyl group at the 2-position contributes to its unique reactivity and properties. The carbonyl chloride functional group, also known as an acyl chloride, is highly reactive, making this compound useful in various synthetic applications, particularly in the formation of amides and esters. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is important to handle it with care due to its potential to release hydrochloric acid upon hydrolysis, which can be corrosive. Additionally, it may exhibit moderate to high toxicity, necessitating appropriate safety precautions during handling and use. Its applications may extend to pharmaceuticals, agrochemicals, and other organic synthesis processes, where it serves as an intermediate or reagent.
Formula:C7H5Cl2NO
InChI:InChI=1S/C7H5Cl2NO/c1-4-6(7(9)11)2-5(8)3-10-4/h2-3H,1H3
InChI key:InChIKey=LRNICVPHBRGCNB-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(C)N=CC(Cl)=C1
Synonyms:- 5-Chloro-2-methyl-3-pyridinecarbonyl chloride
- 3-Pyridinecarbonyl chloride, 5-chloro-2-methyl-
- 5-Chloro-2-methylnicotinoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.