
CAS 1207537-68-5
:Ethyl 5,6-dimethoxybenzo[b]thiophene-2-carboxylate
Description:
Ethyl 5,6-dimethoxybenzo[b]thiophene-2-carboxylate is an organic compound characterized by its complex structure, which includes a thiophene ring fused to a benzene derivative, along with two methoxy groups and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electron-donating methoxy groups. The ethyl ester moiety contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the thiophene ring may impart unique electronic properties, potentially influencing its behavior in biological systems or as a precursor in the synthesis of more complex molecules. Additionally, compounds of this nature may exhibit interesting photophysical properties, which can be leveraged in materials science or as dyes. Overall, Ethyl 5,6-dimethoxybenzo[b]thiophene-2-carboxylate represents a versatile structure with potential applications in various fields of chemistry.
Formula:C13H14O4S
InChI:InChI=1S/C13H14O4S/c1-4-17-13(14)12-6-8-5-9(15-2)10(16-3)7-11(8)18-12/h5-7H,4H2,1-3H3
InChI key:InChIKey=XIYUVNDNLSBEKN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=2C(S1)=CC(OC)=C(OC)C2
Synonyms:- Ethyl 5,6-dimethoxybenzo[b]thiophene-2-carboxylate
- Benzo[b]thiophene-2-carboxylic acid, 5,6-dimethoxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.