CymitQuimica logo

CAS 120758-03-4

:

2-Chloro-3,5-dimethoxyaniline

Description:
2-Chloro-3,5-dimethoxyaniline is an organic compound characterized by the presence of an aniline group substituted with chlorine and methoxy groups. Its molecular structure features a benzene ring with a chlorine atom at the second position and two methoxy groups (-OCH3) at the third and fifth positions. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the chlorine atom and methoxy groups influences its reactivity and polarity, making it useful in various chemical syntheses and applications, including dye production and as an intermediate in pharmaceuticals. Additionally, the methoxy groups can enhance the compound's electron-donating properties, affecting its behavior in electrophilic aromatic substitution reactions. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C8H10ClNO2
InChI:InChI=1S/C8H10ClNO2/c1-11-5-3-6(10)8(9)7(4-5)12-2/h3-4H,10H2,1-2H3
InChI key:QAQJMSZWWPFNJB-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C(=C1)OC)Cl)N
Synonyms:
  • Benzenamine, 2-chloro-3,5-dimethoxy-
Found 5 products.