CymitQuimica logo

CAS 120759-67-3

:

1,3-Dihydro-1-(1-methylethyl)-2H-imidazo[4,5-c]pyridine-2-thione

Description:
1,3-Dihydro-1-(1-methylethyl)-2H-imidazo[4,5-c]pyridine-2-thione, with the CAS number 120759-67-3, is a heterocyclic compound characterized by its imidazole and pyridine rings fused together, which contributes to its unique chemical properties. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and potential biological activity. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, potentially affecting its solubility and interaction with biological membranes. The structure suggests that it may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen and sulfur atoms within its ring system. Overall, this compound represents a class of thione-containing heterocycles that may have applications in drug development and other chemical applications.
Formula:C9H11N3S
InChI:InChI=1S/C9H11N3S/c1-6(2)12-8-3-4-10-5-7(8)11-9(12)13/h3-6H,1-2H3,(H,11,13)
InChI key:InChIKey=HGLZOSYEDKTHPA-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=2C(NC1=S)=CN=CC2
Synonyms:
  • 1,3-Dihydro-1-(1-methylethyl)-2H-imidazo[4,5-c]pyridine-2-thione
  • 2H-Imidazo[4,5-c]pyridine-2-thione, 1,3-dihydro-1-(1-methylethyl)-
  • 1-(Propan-2-yl)-1H-imidazo[4,5-c]pyridine-2-thiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.