
CAS 120759-68-4
:1-Butyl-1,3-dihydro-2H-imidazo[4,5-c]pyridine-2-thione
Description:
1-Butyl-1,3-dihydro-2H-imidazo[4,5-c]pyridine-2-thione is a heterocyclic compound characterized by its imidazo[4,5-c]pyridine core, which features a sulfur atom in the thione functional group. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the butyl group enhances its hydrophobic properties, influencing its solubility and reactivity. As a thione, it can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in coordination chemistry and potential applications in medicinal chemistry. The compound may also exhibit biological activity, although specific pharmacological properties would require further investigation. Its unique structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Overall, 1-butyl-1,3-dihydro-2H-imidazo[4,5-c]pyridine-2-thione is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C10H13N3S
InChI:InChI=1S/C10H13N3S/c1-2-3-6-13-9-4-5-11-7-8(9)12-10(13)14/h4-5,7H,2-3,6H2,1H3,(H,12,14)
InChI key:InChIKey=YAFATTDXXXKCIQ-UHFFFAOYSA-N
SMILES:C(CCC)N1C=2C(NC1=S)=CN=CC2
Synonyms:- 1-Butyl-1H-imidazo[4,5-c]pyridine-2(3H)-thione
- 1-Butyl-1,3-dihydro-2H-imidazo[4,5-c]pyridine-2-thione
- 2H-Imidazo[4,5-c]pyridine-2-thione, 1-butyl-1,3-dihydro-
- 1-Butyl-1H-imidazo[4,5-c]pyridine-2-thiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.