CymitQuimica logo

CAS 1207670-92-5

:

4-Fluoro-3-(trifluoromethyl)pyridine

Description:
4-Fluoro-3-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 4-position and a trifluoromethyl group at the 3-position significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its high stability and low volatility. It exhibits polar characteristics due to the electronegative fluorine atoms, which can enhance its solubility in polar solvents. The trifluoromethyl group contributes to its lipophilicity and can affect its reactivity, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Safety data should be consulted, as fluorinated compounds can pose specific health and environmental risks.
Formula:C6H3F4N
InChI:InChI=1S/C6H3F4N/c7-5-1-2-11-3-4(5)6(8,9)10/h1-3H
InChI key:InChIKey=BWNXRFMPTVLEJG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(F)=CC=NC1
Synonyms:
  • Pyridine, 4-fluoro-3-(trifluoromethyl)-
  • 4-Fluoro-3-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.