CAS 12078-25-0
:Dicarbonyl(η5-cyclopentadienyl)cobalt
Description:
Dicarbonyl(η5-cyclopentadienyl)cobalt, also known as cobalt cyclopentadienyl dicarbonyl, is a coordination compound featuring cobalt in a low oxidation state, typically +1. This compound is characterized by its unique structure, where a cobalt atom is coordinated to a cyclopentadienyl anion (η5-C5H5) and two carbonyl (CO) ligands. The η5 coordination indicates that the cyclopentadienyl ring is bonded to the cobalt atom through all five carbon atoms, creating a stable, aromatic system. Dicarbonyl complexes like this one are often used in organometallic chemistry and catalysis due to their ability to participate in various chemical reactions, including carbonylation and hydrogenation processes. The presence of carbonyl ligands contributes to the compound's reactivity and stability, while the cyclopentadienyl moiety provides a robust framework that enhances the electronic properties of the cobalt center. This compound is typically handled under inert atmospheres due to its sensitivity to air and moisture, which can lead to degradation or oxidation.
Formula:C7H5CoO2
InChI:InChI=1S/C5H5.2CO.Co/c1-2-4-5-3-1;2*1-2;/h1-5H;;;/q-1;;;+1
InChI key:InChIKey=YYRAULYCFRKMHI-UHFFFAOYSA-N
SMILES:C(#O)[Co+]1234(C#O)[CH-]5[CH]1=[CH]2[CH]3=[CH]45
Synonyms:- Cobalt dicarbonyl cyclopentadiene
- Cobalt, dicarbonyl(η<sup>5</sup>-2,4-cyclopentadien-1-yl)-
- Cobalt, dicarbonyl-π-cyclopentadienyl-
- Cobalt, dicarbonylcyclopentadienyl-
- Cyclopentadienylcobalt dicarbonyl
- Cyclopentadienyldicarbonylcobalt
- Dicarbonyl(η<sup>5</sup>-2,4-cyclopentadien-1-yl)cobalt
- Dicarbonyl(η<sup>5</sup>-cyclopentadienyl)cobalt
- Dicarbonyl-π-cyclopentadienyl cobalt
- η<sup>5</sup>-Cyclopentadienylcobalt dicarbonyl
- π-Cyclopentadienylcobalt dicarbonyl
- π-Cyclopentadienyldicarbonylcobalt
- Cobalt, dicarbonyl(η5-2,4-cyclopentadien-1-yl)-
- Cobalt dicarbonyl cyclopentadienyl
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclopentadienylcobalt dicarbonyl, min. 95%
CAS:<p>Cyclopentadienylcobalt dicarbonyl, min. 95%</p>Formula:C5H5Co(CO)2Purity:min. 95%Color and Shape:dark red liq.Molecular weight:180.05Dicarbonylcyclopentadienylcobalt
CAS:Formula:C7H5CoO2Purity:95%Color and Shape:LiquidMolecular weight:180.0466Dicarbonylcyclopentadienylcobalt
CAS:<p>Dicarbonylcyclopentadienylcobalt</p>Purity:0.95Molecular weight:180.05g/molDicarbonylcyclopentadienylcobalt(I)
CAS:Formula:C7H5CoO2Purity:>95.0%(T)Color and Shape:Orange to Brown to Dark purple clear liquid to cloudy liquidMolecular weight:180.05Dicarbonylcyclopentadienylcobalt(I)
CAS:<p>Dicarbonylcyclopentadienylcobalt(I) is a chiral, enantiomerically pure, trimerizing dicarbonyl. It can be used to synthesize aldehydes and acetonitrile. The compound is insoluble in common solvents such as chlorobenzene, bipyridine, and solvents. Preparative methods are required for its isolation.</p>Formula:C7H5CoO2Purity:Min. 95%Molecular weight:180.05 g/molRef: 3D-MAA07825
Discontinued product





