CAS 12078-28-3

Dicarbonyl(η5-2,4-cyclopentadien-1-yl)iodoiron

Description:

Dicarbonyl(η5-2,4-cyclopentadien-1-yl)iodoiron, with the CAS number 12078-28-3, is a coordination compound featuring an iron center coordinated to a cyclopentadienyl ligand and two carbonyl groups. This compound exhibits a unique structure characterized by the presence of an iodine atom, which contributes to its reactivity and potential applications in organometallic chemistry. The cyclopentadienyl ligand, being a five-membered aromatic ring, stabilizes the iron center through π-bonding, while the carbonyl groups provide additional stabilization and influence the electronic properties of the metal. The compound is typically synthesized through the reaction of iron iodide with cyclopentadiene and carbon monoxide. Its properties include moderate thermal stability and solubility in organic solvents, making it useful in various chemical reactions, including catalysis and organic synthesis. Additionally, the presence of the iodine atom may impart unique reactivity patterns, allowing for further functionalization or transformation in synthetic applications.

Formula: C₇H₅FeIO₂

InChI: InChI=1S/C5H5.2CO.Fe.HI/c1-2-4-5-3-1;2*1-2;;/h1-5H;;;;1H/q-1;;;+2;/p-1

InChI key: InChIKey=VCRIZDXFYLQUMV-UHFFFAOYSA-M

SMILES: C(#O)[Fe+2]1234(C#O)([I-])[CH-]5[CH]1=[CH]2[CH]3=[CH]45

Synonyms:

• Iron, dicarbonyl-pi-cyclopentadienyl-, iodide
• Dicarbonyl(η5-2,4-cyclopentadien-1-yl)iodoiron
• Iron, dicarbonyl-π-cyclopentadienyliodo-
• Iron, iododicarbonylcyclopentadienyl-
• Iron, dicarbonyl(η5-2,4-cyclopentadien-1-yl)iodo-
• Cyclopentadienyl-iron dicarbonyl iodide
• Dicarbonyl-π-cyclopentadienyliodoiron
• NSC 107230