CymitQuimica logo

CAS 1207840-37-6

:

4-Iodo-6-methoxy-2-pyridinamine

Description:
4-Iodo-6-methoxy-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of an iodine atom at the 4-position and a methoxy group at the 6-position of the pyridine ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the methoxy group, which can engage in hydrogen bonding. The amino group at the 2-position contributes to its basicity and potential for further chemical reactions, such as nucleophilic substitutions. Additionally, the iodine substituent can enhance the compound's reactivity in various coupling reactions, making it useful in synthetic organic chemistry. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. Safety and handling precautions should be observed due to the presence of iodine, which can be hazardous in certain concentrations.
Formula:C6H7IN2O
InChI:InChI=1S/C6H7IN2O/c1-10-6-3-4(7)2-5(8)9-6/h2-3H,1H3,(H2,8,9)
InChI key:InChIKey=AMLWFBUQYASSRW-UHFFFAOYSA-N
SMILES:O(C)C1=CC(I)=CC(N)=N1
Synonyms:
  • 4-Iodo-6-methoxy-2-pyridinamine
  • 2-Pyridinamine, 4-iodo-6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.