
CAS 120786-56-3
:(R)-Tebuconazole
Description:
(R)-Tebuconazole is a chiral triazole fungicide widely used in agriculture to control various fungal diseases in crops. It is characterized by its ability to inhibit the biosynthesis of ergosterol, a crucial component of fungal cell membranes, thereby disrupting fungal growth and reproduction. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents but has limited solubility in water. Its molecular structure features a triazole ring, which is essential for its fungicidal activity. (R)-Tebuconazole is known for its systemic properties, allowing it to be absorbed by plants and provide protection against pathogens both on the surface and within plant tissues. The compound is generally considered to have low toxicity to mammals and beneficial organisms when used according to recommended guidelines. However, like many agrochemicals, it requires careful handling and application to minimize environmental impact and ensure safety. Its effectiveness and relatively low toxicity profile make it a valuable tool in integrated pest management strategies.
Formula:C16H22ClN3O
InChI:InChI=1S/C16H22ClN3O/c1-15(2,3)16(21,10-20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13/h4-7,11-12,21H,8-10H2,1-3H3/t16-/m0/s1
InChI key:InChIKey=PXMNMQRDXWABCY-INIZCTEOSA-N
SMILES:[C@@](CN1C=NC=N1)(CCC2=CC=C(Cl)C=C2)(C(C)(C)C)O
Synonyms:- 1H-1,2,4-Triazole-1-ethanol, α-[2-(4-chlorophenyl)ethyl]-α-(1,1-dimethylethyl)-, (R)-
- (αR)-α-[2-(4-Chlorophenyl)ethyl]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol
- (R)-Tebuconazole
- 1H-1,2,4-Triazole-1-ethanol, α-[2-(4-chlorophenyl)ethyl]-α-(1,1-dimethylethyl)-, (αR)-
- (+)-HWG 1608
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

