CAS 1207877-87-9

1,1-Dimethylethyl 2,2,4-trimethyl-3-oxo-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 2,2,4-trimethyl-3-oxo-1-piperazinecarboxylate, identified by its CAS number 1207877-87-9, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of multiple methyl groups indicates a degree of steric hindrance, which can influence its physical properties, such as boiling point and melting point, as well as its reactivity. The oxo group (carbonyl) suggests that it may participate in various chemical reactions, including condensation and nucleophilic addition. Additionally, the compound's structure may impart specific biological activities, making it of interest in pharmaceutical and agrochemical research. Overall, its unique combination of functional groups and structural features positions it as a versatile compound in synthetic chemistry and potential applications.

Formula: C₁₂H₂₂N₂O₃

InChI: InChI=1S/C12H22N2O3/c1-11(2,3)17-10(16)14-8-7-13(6)9(15)12(14,4)5/h7-8H2,1-6H3

InChI key: InChIKey=ITFDFKVTXMWPRM-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(C)(C)C(=O)N(C)CC1

Synonyms:

• 1,1-Dimethylethyl 2,2,4-trimethyl-3-oxo-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 2,2,4-trimethyl-3-oxo-, 1,1-dimethylethyl ester