CAS 120796-25-0
:keto-anhydrokinamycin
Description:
Keto-anhydrokinamycin is a chemical compound that belongs to the class of antibiotics known as ansamycins, which are characterized by their complex polycyclic structures. This substance is notable for its potential antibacterial properties, particularly against certain strains of bacteria. The compound features a keto group, which is a carbonyl functional group (C=O) located within its molecular structure, contributing to its reactivity and biological activity. Additionally, the presence of an anhydro structure indicates the absence of a water molecule that would typically be present in a hydrated form, which can influence its stability and solubility. Keto-anhydrokinamycin has been studied for its mechanism of action, which often involves inhibition of bacterial RNA synthesis, making it a candidate for further research in antibiotic development. Its specific applications and efficacy can vary based on the context of use, including potential resistance mechanisms in target bacteria. As with many antibiotics, understanding its pharmacokinetics and pharmacodynamics is crucial for evaluating its therapeutic potential.
Formula:C18H10N2O6
InChI:InChI=1/C18H10N2O6/c1-18-16(25)11-9(15(24)17(18)26-18)8-10(12(11)20-19)14(23)7-5(13(8)22)3-2-4-6(7)21/h2-4,15,17,24H,1H3,(H-,21,22,23,25)
Synonyms:- 9-diazonio-2,8-dihydroxy-10a-methyl-7,10-dioxo-2,7,10,10a-tetrahydro-1aH-benzo[6,7]fluoreno[2,3-b]oxiren-3-olate
- Keto-anhydrokinamycin
- Ketoanhydrokinamycin
- 3H-Benz(b)oxireno(h)carbazole-3-carbonitrile, 1a,2,4,9,10,10a-hexahydro-5,10-dihydroxy-1a-methyl-2,4,9-trioxo-, (1aS-(1aalpha,10beta,10aalpha))-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Keto-anhydrokinamycin
CAS:Keto-anhydrokinamycin, as a keto-epoxide kinamycin intermediate, is isolated from Streptomyces murayamaensis.Formula:C18H10N2O6Color and Shape:SolidMolecular weight:350.286
