CAS 120800-51-3

4-(4-Morpholinyl)-3-pyridinecarboxylic acid

Description:

4-(4-Morpholinyl)-3-pyridinecarboxylic acid, with the CAS number 120800-51-3, is a chemical compound characterized by its pyridine and morpholine functional groups. This compound typically exhibits properties associated with both heterocyclic amines and carboxylic acids, which may influence its solubility and reactivity. It is often utilized in pharmaceutical research due to its potential biological activity, particularly in the development of therapeutic agents. The presence of the morpholine ring contributes to its ability to interact with biological targets, while the carboxylic acid group can participate in hydrogen bonding and ionic interactions. The compound is likely to be a solid at room temperature and may have moderate to high solubility in polar solvents, such as water and alcohols. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the synthesis of compounds with antimicrobial or anti-inflammatory properties. As with many chemical substances, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₁₀H₁₂N₂O₃

InChI: InChI=1S/C10H12N2O3/c13-10(14)8-7-11-2-1-9(8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14)

InChI key: InChIKey=DJAAOYBMOGDECA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CC=NC1)N2CCOCC2

Synonyms:

• 4-Morpholinonicotinic acid
• 4-(4-Morpholinyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-(4-morpholinyl)-