CAS 120801-75-4
:Trimethylsilyl 2-(fluorosulfonyl)difluoroacetate
Description:
Trimethylsilyl 2-(fluorosulfonyl)difluoroacetate, with the CAS number 120801-75-4, is a chemical compound characterized by its unique functional groups and reactivity. It features a trimethylsilyl group, which enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The presence of the fluorosulfonyl group contributes to its electrophilic nature, allowing it to participate in nucleophilic substitution reactions. Additionally, the difluoroacetate moiety imparts distinctive properties, such as increased lipophilicity and potential for further functionalization. This compound is typically used in organic synthesis, particularly in the preparation of fluorinated compounds, due to its ability to introduce fluorine and sulfonyl functionalities. Its reactivity and stability make it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose hazards typical of fluorinated and sulfonyl-containing chemicals.
Formula:C7H2Cl2FNO3
InChI:InChI=1/C7H2Cl2FNO3/c8-4-2-5(10)6(11(13)14)1-3(4)7(9)12/h1-2H
SMILES:c1c(c(cc(c1N(=O)=O)F)Cl)C(=O)Cl
Synonyms:- Trimethylsilyl Fluorosulfonyldifluoroacetate
- Trimethylsilyl 2,2-Difluoro-2-(Fluorosulfonyl)Acetate
- Trimethylsilyl 2-(Fluorosulphonyl)Difluoroacetate
- Trimethylsilyl 2,2-Difluoro-2-(Fluorosul
- Trimethylsilyl2-(Fluorosulphonyl)Difluoroacetate
- Trimethylsilyl Difluoro(Fluorosulfonyl)Acetate
- Trimethylsilyl-2(Fluorosulfonyl)Difluoroacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Trimethylsilyl Difluoro(fluorosulfonyl)acetate
CAS:Formula:C5H9F3O4SSiPurity:>96.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:250.26Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate, 94%
CAS:Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate is an fluoroalkylation agent, reactant for preparation of difluorocyclopropenes, preparation of difluorocarbene reagents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation aFormula:C5H9F3O4SSiPurity:94%Color and Shape:Clear, colorless to pale yellow, LiquidMolecular weight:250.26Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate
CAS:Formula:C5H9F3O4SSiPurity:95%Color and Shape:LiquidMolecular weight:250.2683Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetate
CAS:Trimethylsilyl 2,2-difluoro-2-(fluorosulfonyl)acetatePurity:95%Molecular weight:250.27g/molTrimethylsilyl fluorosulfonyldifluoroacetate
CAS:Formula:C5H9F3O4SSiPurity:95%Color and Shape:Liquid, ClearMolecular weight:250.26




