
CAS 1208071-22-0
:3-Hydroxy-2-pyridinecarboximidamide
Description:
3-Hydroxy-2-pyridinecarboximidamide, identified by its CAS number 1208071-22-0, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a carboximidamide functional group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the carboximidamide moiety can participate in hydrogen bonding and may influence its reactivity and interaction with biological targets. The compound's structure suggests it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological data would be necessary to confirm these effects. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Hydroxy-2-pyridinecarboximidamide represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C6H7N3O
InChI:InChI=1S/C6H7N3O/c7-6(8)5-4(10)2-1-3-9-5/h1-3,10H,(H3,7,8)
InChI key:InChIKey=MHBWLFBRFFFVTI-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(O)C=CC=N1
Synonyms:- 2-Pyridinecarboximidamide, 3-hydroxy-
- 3-Hydroxy-2-pyridinecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.