CAS 1208074-76-3

3,5-Difluoro-2-methoxybenzenethiol

Description:

3,5-Difluoro-2-methoxybenzenethiol is an organic compound characterized by the presence of a thiol group (-SH) attached to a benzene ring that is further substituted with two fluorine atoms and a methoxy group (-OCH3). The fluorine substituents are located at the 3 and 5 positions of the benzene ring, while the methoxy group is at the 2 position, contributing to the compound's overall reactivity and polarity. This compound is likely to exhibit properties typical of thiols, such as a strong, often unpleasant odor, and it may participate in various chemical reactions, including nucleophilic substitutions and oxidation. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its biological activity. Additionally, the methoxy group can affect the electronic properties of the aromatic system, potentially altering its reactivity. Overall, 3,5-Difluoro-2-methoxybenzenethiol is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.

Formula: C₇H₆F₂OS

InChI: InChI=1S/C7H6F2OS/c1-10-7-5(9)2-4(8)3-6(7)11/h2-3,11H,1H3

InChI key: InChIKey=OTGUJVPNJNSJMN-UHFFFAOYSA-N

SMILES: O(C)C1=C(F)C=C(F)C=C1S

Synonyms:

• Benzenethiol, 3,5-difluoro-2-methoxy-
• 3,5-Difluoro-2-methoxybenzenethiol