CAS 1208074-80-9

3-(Difluoromethoxy)benzenemethanethiol

Description:

3-(Difluoromethoxy)benzenemethanethiol is an organic compound characterized by the presence of a thiol group (-SH) attached to a benzene ring that also features a difluoromethoxy substituent. This compound belongs to the class of thiophenols, which are known for their aromatic properties and the reactivity of the thiol group. The difluoromethoxy group introduces both electronegative fluorine atoms and an ether-like oxygen, which can influence the compound's polarity, solubility, and reactivity. The presence of fluorine atoms typically enhances the compound's stability and can affect its interaction with biological systems, making it of interest in medicinal chemistry and materials science. Additionally, the thiol group can participate in various chemical reactions, including nucleophilic substitutions and disulfide bond formation, which are important in organic synthesis and biochemistry. Overall, 3-(Difluoromethoxy)benzenemethanethiol exhibits unique properties that make it a valuable compound for research and potential applications in various fields.

Formula: C₈H₈F₂OS

InChI: InChI=1S/C8H8F2OS/c9-8(10)11-7-3-1-2-6(4-7)5-12/h1-4,8,12H,5H2

InChI key: InChIKey=HZJMZDVAYNCAHU-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC(CS)=CC=C1

Synonyms:

• Benzenemethanethiol, 3-(difluoromethoxy)-
• 3-(Difluoromethoxy)benzenemethanethiol

[3-(Difluoromethoxy)phenyl]methanethiol

CAS: 1208074-80-9

Versatile small molecule scaffold

Formula: C₈H₈F₂OS

Purity: Min. 95%

Molecular weight: 190.21 g/mol

Ref: 3D-IYB07480