CymitQuimica logo

CAS 1208074-88-7

:

1,5-Diethoxy-2-fluoro-4-iodobenzene

Description:
1,5-Diethoxy-2-fluoro-4-iodobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two ethoxy groups, a fluorine atom, and an iodine atom. The presence of the ethoxy groups contributes to its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The fluorine atom typically enhances the compound's stability and can affect its electronic properties, while the iodine atom may introduce additional reactivity due to its larger size and ability to participate in various chemical reactions, such as nucleophilic substitutions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, where halogenated aromatic compounds often play a crucial role. Additionally, the specific arrangement of substituents on the benzene ring can lead to unique physical and chemical properties, including variations in boiling and melting points, as well as reactivity patterns.
Formula:C10H12FIO2
InChI:InChI=1S/C10H12FIO2/c1-3-13-9-6-10(14-4-2)8(12)5-7(9)11/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=UZYJGLCVCJVZCJ-UHFFFAOYSA-N
SMILES:O(CC)C1=CC(OCC)=C(I)C=C1F
Synonyms:
  • Benzene, 1,5-diethoxy-2-fluoro-4-iodo-
  • 1,5-Diethoxy-2-fluoro-4-iodobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.