
CAS 1208075-30-2
:Methyl 3-bromo-4-iodobenzeneacetate
Description:
Methyl 3-bromo-4-iodobenzeneacetate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and iodine atoms, as well as an ester functional group. The presence of the bromine and iodine substituents on the benzene ring significantly influences its reactivity and physical properties, such as solubility and boiling point. The ester group contributes to its potential applications in organic synthesis and medicinal chemistry, as esters are often involved in various chemical reactions, including hydrolysis and transesterification. This compound is typically used as an intermediate in the synthesis of more complex organic molecules. Its molecular structure suggests that it may exhibit interesting electronic properties due to the halogen substituents, which can affect the electron density of the aromatic system. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents, making it a valuable compound for research in synthetic organic chemistry.
Formula:C9H8BrIO2
InChI:InChI=1S/C9H8BrIO2/c1-13-9(12)5-6-2-3-8(11)7(10)4-6/h2-4H,5H2,1H3
InChI key:InChIKey=YSQISPDDCMZLFK-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=CC(Br)=C(I)C=C1
Synonyms:- Methyl 3-bromo-4-iodobenzeneacetate
- Benzeneacetic acid, 3-bromo-4-iodo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.