
CAS 1208075-45-9
:2-Bromo-6-chloro-4-fluorobenzenesulfonamide
Description:
2-Bromo-6-chloro-4-fluorobenzenesulfonamide is an organic compound characterized by its complex structure, which includes a benzene ring substituted with a bromine atom, a chlorine atom, and a fluorine atom, along with a sulfonamide functional group. This compound is typically a solid at room temperature and is soluble in polar organic solvents. The presence of multiple halogen substituents contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and material science. The sulfonamide group enhances its ability to form hydrogen bonds, which can influence its interactions in biological systems. Additionally, the compound may exhibit properties such as antimicrobial activity or serve as a building block in the synthesis of more complex molecules. Its unique combination of halogens and the sulfonamide moiety may also impart specific electronic and steric properties, affecting its behavior in chemical reactions and applications. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C6H4BrClFNO2S
InChI:InChI=1S/C6H4BrClFNO2S/c7-4-1-3(9)2-5(8)6(4)13(10,11)12/h1-2H,(H2,10,11,12)
InChI key:InChIKey=YJQIWWMPGTYXSX-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(Br)C=C(F)C=C1Cl
Synonyms:- Benzenesulfonamide, 2-bromo-6-chloro-4-fluoro-
- 2-Bromo-6-chloro-4-fluorobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.