CymitQuimica logo

CAS 1208075-47-1

:

2,5-Difluoro-4-methoxybenzenesulfonyl chloride

Description:
2,5-Difluoro-4-methoxybenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a benzene ring substituted with two fluorine atoms at the 2 and 5 positions and a methoxy group at the 4 position, contributing to its unique electronic properties and potential applications in medicinal chemistry and material science. The presence of fluorine atoms enhances the lipophilicity and metabolic stability of the compound, making it of interest in drug design. Additionally, the sulfonyl chloride group is a versatile electrophile, allowing for further derivatization and functionalization. This compound is typically handled with care due to its reactive nature, particularly in the presence of moisture, which can lead to hydrolysis. Overall, 2,5-Difluoro-4-methoxybenzenesulfonyl chloride is a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C7H5ClF2O3S
InChI:InChI=1S/C7H5ClF2O3S/c1-13-6-2-5(10)7(3-4(6)9)14(8,11)12/h2-3H,1H3
InChI key:InChIKey=CUTNXALJOYAPJT-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(F)C=C(OC)C(F)=C1
Synonyms:
  • 2,5-Difluoro-4-methoxybenzene-1-sulfonyl chloride
  • 2,5-Difluoro-4-methoxybenzenesulfonyl chloride
  • Benzenesulfonyl chloride, 2,5-difluoro-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.