CAS 1208075-66-4
:3,5-Dichloro-4-fluorobenzenesulfonamide
Description:
3,5-Dichloro-4-fluorobenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group attached to a benzene ring that is substituted with two chlorine atoms and one fluorine atom. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, including potential solubility in polar solvents and moderate stability under standard conditions. The presence of halogen substituents, specifically chlorine and fluorine, can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the sulfonamide group may impart biological activity, as many sulfonamides are known for their antimicrobial properties. The compound's molecular structure suggests it may be used in pharmaceutical applications or as an intermediate in organic synthesis. Safety data should be consulted for handling and potential hazards, as the presence of halogens can also indicate toxicity or environmental concerns. Overall, 3,5-Dichloro-4-fluorobenzenesulfonamide is a compound of interest in both chemical research and industrial applications.
Formula:C6H4Cl2FNO2S
InChI:InChI=1S/C6H4Cl2FNO2S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,(H2,10,11,12)
InChI key:InChIKey=LFKZJSPGKPVFHW-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(Cl)=C(F)C(Cl)=C1
Synonyms:- 3,5-Dichloro-4-fluorobenzenesulfonamide
- Benzenesulfonamide, 3,5-dichloro-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
