
CAS 1208076-00-9
:1-Bromo-3-methyl-2-(1-methylethoxy)benzene
Description:
1-Bromo-3-methyl-2-(1-methylethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an ether functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The methyl group and the 1-methylethoxy group contribute to the compound's hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. This compound is likely to exhibit moderate volatility due to its molecular structure. Additionally, the presence of the ether group can affect its reactivity and stability, potentially allowing for further functionalization. As with many brominated compounds, it may pose environmental and health concerns, necessitating careful handling and consideration of its use in chemical processes. Overall, 1-Bromo-3-methyl-2-(1-methylethoxy)benzene is a versatile compound with applications in organic synthesis and materials science.
Formula:C10H13BrO
InChI:InChI=1S/C10H13BrO/c1-7(2)12-10-8(3)5-4-6-9(10)11/h4-7H,1-3H3
InChI key:InChIKey=OGSJAYXEZDMQMV-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(Br)C=CC=C1C
Synonyms:- 1-Bromo-3-methyl-2-(1-methylethoxy)benzene
- Benzene, 1-bromo-3-methyl-2-(1-methylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.