CAS 1208076-16-7

3-Amino-2,4-dibromo-6-chlorobenzoic acid

Description:

3-Amino-2,4-dibromo-6-chlorobenzoic acid is an organic compound characterized by the presence of an amino group, multiple halogen substituents, and a carboxylic acid functional group. The compound features a benzene ring that is substituted at the 2, 4, and 6 positions with bromine and chlorine atoms, contributing to its reactivity and potential applications in various chemical reactions. The amino group at the 3-position enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its biological activity. The presence of halogens typically increases the compound's lipophilicity and can affect its interaction with biological systems. This compound may be of interest in pharmaceutical research, agrochemicals, or materials science due to its unique structural features. Additionally, the presence of multiple halogens can impart specific electronic properties, making it a candidate for further studies in medicinal chemistry or as a building block in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₇H₄Br₂ClNO₂

InChI: InChI=1S/C7H4Br2ClNO2/c8-2-1-3(10)4(7(12)13)5(9)6(2)11/h1H,11H2,(H,12,13)

InChI key: InChIKey=GKKHMSREATWSKI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C(N)=C(Br)C=C1Cl

Synonyms:

• Benzoic acid, 3-amino-2,4-dibromo-6-chloro-
• 3-Amino-2,4-dibromo-6-chlorobenzoic acid