CAS 1208076-19-0

4-Piperidinamine, 1-cyclohexyl-, hydrochloride (1:1)

Description:

4-Piperidinamine, 1-cyclohexyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclohexyl group enhances its hydrophobic properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as basicity due to the amine functional group, which can participate in hydrogen bonding and interact with biological targets. Its specific applications and effects would depend on its interaction with biological systems, which could include roles in medicinal chemistry or as a potential therapeutic agent. Safety and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities, which can be reactive and may pose health risks if not managed properly.

Formula: C₁₁H₂₂N₂·ClH

InChI: InChI=1S/C11H22N2.ClH/c12-10-6-8-13(9-7-10)11-4-2-1-3-5-11;/h10-11H,1-9,12H2;1H

InChI key: InChIKey=MYWITWLLTZCQBU-UHFFFAOYSA-N

SMILES: NC1CCN(CC1)C2CCCCC2.Cl

Synonyms:

• 4-Piperidinamine, 1-cyclohexyl-, hydrochloride (1:1)