CAS 1208076-25-8
:4-Chloro-2,5-difluorobenzenethiol
Description:
4-Chloro-2,5-difluorobenzenethiol is an organosulfur compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that is further substituted with chlorine and fluorine atoms. The molecular structure features a benzene ring with a chlorine atom at the para position and two fluorine atoms at the meta positions relative to the thiol group. This compound exhibits properties typical of thiols, including a strong, often unpleasant odor, and is known for its reactivity due to the presence of the thiol functional group, which can participate in various chemical reactions, such as nucleophilic substitutions and oxidation. The presence of halogen substituents can influence the compound's polarity, solubility, and reactivity, making it of interest in various chemical applications, including synthesis and material science. Additionally, the compound's unique combination of functional groups may impart specific biological activities, warranting further investigation in medicinal chemistry and environmental studies.
Formula:C6H3ClF2S
InChI:InChI=1S/C6H3ClF2S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H
InChI key:InChIKey=BLNYIJVOSLPOLA-UHFFFAOYSA-N
SMILES:ClC1=C(F)C=C(S)C(F)=C1
Synonyms:- Benzenethiol, 4-chloro-2,5-difluoro-
- 4-Chloro-2,5-difluorobenzenethiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
