
CAS 1208076-33-8
:1,3-Diethoxy-2-fluoro-4-iodobenzene
Description:
1,3-Diethoxy-2-fluoro-4-iodobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two ethoxy groups, a fluorine atom, and an iodine atom. The presence of the ethoxy groups contributes to its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The fluorine atom typically enhances the compound's stability and can affect its electronic properties, while the iodine atom may introduce unique reactivity due to its larger size and lower electronegativity compared to other halogens. This compound may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential as a building block in synthetic chemistry. Additionally, the specific arrangement of substituents on the benzene ring can lead to distinct physical and chemical properties, such as boiling and melting points, as well as reactivity patterns in electrophilic aromatic substitution reactions. Overall, 1,3-Diethoxy-2-fluoro-4-iodobenzene is a versatile compound with significant implications in chemical research and industry.
Formula:C10H12FIO2
InChI:InChI=1S/C10H12FIO2/c1-3-13-8-6-5-7(12)10(9(8)11)14-4-2/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=MAWGRVWSSNBKBV-UHFFFAOYSA-N
SMILES:O(CC)C1=C(F)C(OCC)=CC=C1I
Synonyms:- Benzene, 1,3-diethoxy-2-fluoro-4-iodo-
- 1,3-Diethoxy-2-fluoro-4-iodobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.