CAS 1208076-54-3

1-(2-Bromo-3,6-difluorophenyl)-2,2,2-trifluoroethanone

Description:

1-(2-Bromo-3,6-difluorophenyl)-2,2,2-trifluoroethanone is a synthetic organic compound characterized by its complex halogenated structure. It features a trifluoroethanone moiety, which contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of bromine and fluorine atoms enhances its electrophilic properties, making it a valuable intermediate in organic synthesis. This compound is likely to exhibit significant lipophilicity due to the trifluoromethyl groups, which can influence its biological activity and solubility in organic solvents. Additionally, the presence of multiple halogens may impart unique physical properties, such as increased stability and altered melting and boiling points compared to non-halogenated analogs. Safety considerations are essential when handling this compound, as halogenated substances can pose environmental and health risks. Overall, 1-(2-Bromo-3,6-difluorophenyl)-2,2,2-trifluoroethanone represents a noteworthy example of modern synthetic chemistry, with potential applications in various fields.

Formula: C₈H₂BrF₅O

InChI: InChI=1S/C8H2BrF5O/c9-6-4(11)2-1-3(10)5(6)7(15)8(12,13)14/h1-2H

InChI key: InChIKey=OFYMBJSPBDSBED-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=C(Br)C(F)=CC=C1F

Synonyms:

• Ethanone, 1-(2-bromo-3,6-difluorophenyl)-2,2,2-trifluoro-
• 1-(2-Bromo-3,6-difluorophenyl)-2,2,2-trifluoroethanone

2'-Bromo-3',6',2,2,2-pentafluoroacetophenone

CAS: 1208076-54-3

2'-Bromo-3',6',2,2,2-pentafluoroacetophenone

Formula: C₈H₂BrF₅O

Purity: 95%

Color and Shape: clear. colourless liquid

Molecular weight: 289.00g/mol

Ref: 54-PC57434