CAS 1208076-84-9
:4-Bromo-5-chloro-2-methylbenzenesulfonyl chloride
Description:
4-Bromo-5-chloro-2-methylbenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a benzene ring substituted with a bromine atom at the 4-position, a chlorine atom at the 5-position, and a methyl group at the 2-position, contributing to its unique chemical properties. The presence of both halogen substituents enhances its electrophilic character, making it a useful intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Additionally, the sulfonyl chloride group is highly reactive, allowing for the introduction of various nucleophiles. This compound is typically handled with care due to its potential to release toxic gases upon hydrolysis and its corrosive nature. As with many sulfonyl chlorides, it is important to store it in a cool, dry place, away from moisture and incompatible materials to maintain its stability and reactivity.
Formula:C7H5BrCl2O2S
InChI:InChI=1S/C7H5BrCl2O2S/c1-4-2-5(8)6(9)3-7(4)13(10,11)12/h2-3H,1H3
InChI key:InChIKey=AJQBBVFQJBVCJS-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(C)C=C(Br)C(Cl)=C1
Synonyms:- 4-Bromo-5-chloro-2-methylbenzenesulfonyl chloride
- Benzenesulfonyl chloride, 4-bromo-5-chloro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.