CymitQuimica logo

CAS 1208076-87-2

:

5-Chloro-2,4-difluorobenzenethiol

Description:
5-Chloro-2,4-difluorobenzenethiol is an organosulfur compound characterized by the presence of a thiol (-SH) functional group attached to a benzene ring that is substituted with chlorine and fluorine atoms. The molecular structure features a benzene ring with a chlorine atom at the 5-position and two fluorine atoms at the 2 and 4 positions, contributing to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of both electronegative halogens and the thiol group can influence its chemical behavior, making it a candidate for nucleophilic substitution reactions. Additionally, the compound's properties, such as solubility and volatility, can be affected by the substituents on the benzene ring, which may also impact its environmental persistence and toxicity. Safety precautions should be taken when handling this substance due to its potential health hazards.
Formula:C6H3ClF2S
InChI:InChI=1S/C6H3ClF2S/c7-3-1-6(10)5(9)2-4(3)8/h1-2,10H
InChI key:InChIKey=WNGWOEGJKYNQDC-UHFFFAOYSA-N
SMILES:ClC1=C(F)C=C(F)C(S)=C1
Synonyms:
  • Benzenethiol, 5-chloro-2,4-difluoro-
  • 5-Chloro-2,4-difluorobenzenethiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.