CAS 1208076-94-1

3-Amino-2,4-dibromo-6-fluorobenzoic acid

Description:

3-Amino-2,4-dibromo-6-fluorobenzoic acid is an organic compound characterized by the presence of an amino group, multiple bromine atoms, and a fluorine atom attached to a benzoic acid structure. This compound features a benzene ring substituted at specific positions, which influences its chemical reactivity and physical properties. The amino group (-NH2) typically imparts basic characteristics, while the carboxylic acid group (-COOH) contributes acidic properties. The presence of bromine and fluorine atoms enhances the compound's electronegativity and can affect its solubility in various solvents. Additionally, the dibromo and fluoro substitutions can lead to unique interactions in biological systems, making it of interest in pharmaceutical and agrochemical research. The compound may exhibit specific melting and boiling points, solubility characteristics, and reactivity patterns that are typical of halogenated aromatic compounds. Overall, 3-Amino-2,4-dibromo-6-fluorobenzoic acid is a complex molecule with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₇H₄Br₂FNO₂

InChI: InChI=1S/C7H4Br2FNO2/c8-2-1-3(10)4(7(12)13)5(9)6(2)11/h1H,11H2,(H,12,13)

InChI key: InChIKey=CGLLQHZRHZOGAE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C(N)=C(Br)C=C1F

Synonyms:

• Benzoic acid, 3-amino-2,4-dibromo-6-fluoro-
• 3-Amino-2,4-dibromo-6-fluorobenzoic acid