CAS 1208076-99-6

Ethyl 3-amino-2,6-dibromo-4-methoxybenzoate

Description:

Ethyl 3-amino-2,6-dibromo-4-methoxybenzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety with various substituents. The presence of the ethyl ester group contributes to its solubility in organic solvents, while the amino group introduces potential for hydrogen bonding and reactivity in various chemical reactions. The dibromo substituents at the 2 and 6 positions of the aromatic ring enhance the compound's electrophilic character, making it useful in synthetic applications, particularly in the development of pharmaceuticals or agrochemicals. The methoxy group at the 4 position can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interaction with biological targets. Overall, this compound's unique combination of functional groups and substituents makes it a valuable candidate for further research in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental methods or detailed literature review.

Formula: C₁₀H₁₁Br₂NO₃

InChI: InChI=1S/C10H11Br2NO3/c1-3-16-10(14)7-5(11)4-6(15-2)9(13)8(7)12/h4H,3,13H2,1-2H3

InChI key: InChIKey=DBZFYTCWNFLGIB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(Br)C(N)=C(OC)C=C1Br

Synonyms:

• Benzoic acid, 3-amino-2,6-dibromo-4-methoxy-, ethyl ester
• Ethyl 3-amino-2,6-dibromo-4-methoxybenzoate