CAS 1208077-06-8

4-Bromo-5-chloro-2-methylbenzenesulfonamide

Description:

4-Bromo-5-chloro-2-methylbenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a substituted aromatic ring. The compound features a bromine atom and a chlorine atom as substituents on the benzene ring, which contribute to its reactivity and potential applications in various chemical reactions. The methyl group further influences the compound's electronic properties and steric hindrance. This sulfonamide derivative is typically used in medicinal chemistry and may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on the conditions and solvents used. The presence of halogens often enhances the compound's ability to participate in electrophilic aromatic substitution reactions. Additionally, the sulfonamide group can engage in hydrogen bonding, affecting its interactions in biological systems. Overall, 4-Bromo-5-chloro-2-methylbenzenesulfonamide is a versatile compound with potential applications in drug development and synthetic chemistry.

Formula: C₇H₇BrClNO₂S

InChI: InChI=1S/C7H7BrClNO2S/c1-4-2-5(8)6(9)3-7(4)13(10,11)12/h2-3H,1H3,(H2,10,11,12)

InChI key: InChIKey=SMKMPYCPCCOIHB-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(C)C=C(Br)C(Cl)=C1

Synonyms:

• Benzenesulfonamide, 4-bromo-5-chloro-2-methyl-
• 4-Bromo-5-chloro-2-methylbenzenesulfonamide